C23H20N4O — CID 134052696
2,3-dimethyl-N-[phenyl(pyridin-2-yl)methyl]quinoxaline-6-carboxamide (PubChem CID 134052696) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 2,3-dimethyl-N-[phenyl(pyridin-2-yl)methyl]quinoxaline-6-carboxamide.
| Compound Name | 2,3-dimethyl-N-[phenyl(pyridin-2-yl)methyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 134052696 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2,3-dimethyl-N-[phenyl(pyridin-2-yl)methyl]quinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NC(c3ccccc3)c3ccccn3)cc2nc1C |
| InChI | InChI=1S/C23H20N4O/c1-15-16(2)26-21-14-18(11-12-19(21)25-15)23(28)27-22(17-8-4-3-5-9-17)20-10-6-7-13-24-20/h3-14,22H,1-2H3,(H,27,28) |
| InChIKey | ILUNAPNRKHZJIP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |