C20H16F2N2OS — CID 134025916
4-(difluoromethylsulfanyl)-N-[phenyl(pyridin-2-yl)methyl]benzamide (PubChem CID 134025916) has the molecular formula C20H16F2N2OS and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[phenyl(pyridin-2-yl)methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[phenyl(pyridin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 134025916 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[phenyl(pyridin-2-yl)methyl]benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccn1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C20H16F2N2OS/c21-20(22)26-16-11-9-15(10-12-16)19(25)24-18(14-6-2-1-3-7-14)17-8-4-5-13-23-17/h1-13,18,20H,(H,24,25) |
| InChIKey | VWPMMZMCSCTNDT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |