C22H19F3N2O2 — CID 46550378
N-[phenyl(pyridin-2-yl)methyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 46550378) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[phenyl(pyridin-2-yl)methyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-[phenyl(pyridin-2-yl)methyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 46550378 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[phenyl(pyridin-2-yl)methyl]-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccn1)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3N2O2/c23-22(24,25)15-29-14-16-9-11-18(12-10-16)21(28)27-20(17-6-2-1-3-7-17)19-8-4-5-13-26-19/h1-13,20H,14-15H2,(H,27,28) |
| InChIKey | NBUVFYKTUURZHU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |