C17H14N4O2 — CID 43008369
6-oxo-N-[phenyl(pyridin-2-yl)methyl]-1H-pyridazine-3-carboxamide (PubChem CID 43008369) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 6-oxo-N-[phenyl(pyridin-2-yl)methyl]-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-[phenyl(pyridin-2-yl)methyl]-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 43008369 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 6-oxo-N-[phenyl(pyridin-2-yl)methyl]-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccn1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C17H14N4O2/c22-15-10-9-14(20-21-15)17(23)19-16(12-6-2-1-3-7-12)13-8-4-5-11-18-13/h1-11,16H,(H,19,23)(H,21,22) |
| InChIKey | JURIGIYFHMVSIT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |