C21H26N2O3 — CID 134054283
1-(furan-2-carbonyl)-N-methyl-N-[1-(4-methylphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 134054283) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)-N-methyl-N-[1-(4-methylphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(furan-2-carbonyl)-N-methyl-N-[1-(4-methylphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134054283 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-(furan-2-carbonyl)-N-methyl-N-[1-(4-methylphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(C(C)N(C)C(=O)C2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-15-6-8-17(9-7-15)16(2)22(3)20(24)18-10-12-23(13-11-18)21(25)19-5-4-14-26-19/h4-9,14,16,18H,10-13H2,1-3H3 |
| InChIKey | YOHMBVIENNELLG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |