C18H25N3OS — CID 134056882
1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 134056882) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 134056882 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[[2-(diethylaminomethyl)phenyl]methyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)NCc1cccs1 |
| InChI | InChI=1S/C18H25N3OS/c1-3-21(4-2)14-16-9-6-5-8-15(16)12-19-18(22)20-13-17-10-7-11-23-17/h5-11H,3-4,12-14H2,1-2H3,(H2,19,20,22) |
| InChIKey | NWOIIRSOXJEJKG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |