C23H24N2O2 — CID 134057616
(2E,4E)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]hexa-2,4-dienamide (PubChem CID 134057616) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (2E,4E)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 134057616 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2E,4E)-N-[2-(1H-indol-3-yl)-2-(4-methoxyphenyl)ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCC(c1ccc(OC)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N2O2/c1-3-4-5-10-23(26)25-15-20(17-11-13-18(27-2)14-12-17)21-16-24-22-9-7-6-8-19(21)22/h3-14,16,20,24H,15H2,1-2H3,(H,25,26)/b4-3+,10-5+ |
| InChIKey | KZNHYCAXOZCRDG-COBAKMAKSA-N |
| XLogP | 4.56 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|