C15H23N3OS — CID 134057702
N-(2-ethylhexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide (PubChem CID 134057702) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide.
| Compound Name | N-(2-ethylhexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
|---|---|
| PubChem CID | 134057702 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(2-ethylhexyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylacetamide |
| SMILES | CCCCC(CC)CNC(=O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C15H23N3OS/c1-3-5-6-12(4-2)10-16-14(19)9-13-11-18-7-8-20-15(18)17-13/h7-8,11-12H,3-6,9-10H2,1-2H3,(H,16,19) |
| InChIKey | HNQTZSABINVOBV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |