C18H23F3N4OS — CID 134058268
1-[[5-(2-methoxyethylsulfanyl)-4-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]piperidine (PubChem CID 134058268) has the molecular formula C18H23F3N4OS and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-[[5-(2-methoxyethylsulfanyl)-4-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]piperidine.
| Compound Name | 1-[[5-(2-methoxyethylsulfanyl)-4-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 134058268 |
| Molecular Formula | C18H23F3N4OS |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[[5-(2-methoxyethylsulfanyl)-4-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]piperidine |
| SMILES | COCCSc1nnc(CN2CCCCC2)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H23F3N4OS/c1-26-11-12-27-17-23-22-16(13-24-9-5-2-6-10-24)25(17)15-8-4-3-7-14(15)18(19,20)21/h3-4,7-8H,2,5-6,9-13H2,1H3 |
| InChIKey | NCUSCJQKOMYNIU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|