C13H10Cl3N3O2 — CID 134062108
2-methoxy-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide (PubChem CID 134062108) has the molecular formula C13H10Cl3N3O2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 2-methoxy-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide.
| Compound Name | 2-methoxy-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 134062108 |
| Molecular Formula | C13H10Cl3N3O2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2-methoxy-N'-(2,4,6-trichlorophenyl)pyridine-3-carbohydrazide |
| SMILES | COc1ncccc1C(=O)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O2/c1-21-13-8(3-2-4-17-13)12(20)19-18-11-9(15)5-7(14)6-10(11)16/h2-6,18H,1H3,(H,19,20) |
| InChIKey | WTDVULQQCAYKQM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|