C13H23N3OS2 — CID 134065032
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide (PubChem CID 134065032) has the molecular formula C13H23N3OS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 134065032 |
| Molecular Formula | C13H23N3OS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-[2-(dimethylamino)ethylsulfanyl]acetamide |
| SMILES | CN(C)CCSCC(=O)Nc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C13H23N3OS2/c1-13(2,3)10-8-19-12(14-10)15-11(17)9-18-7-6-16(4)5/h8H,6-7,9H2,1-5H3,(H,14,15,17) |
| InChIKey | FLNYDZHGMSXLDQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|