C24H25Cl2N3S — CID 134066312
4-cyclohexyl-3-[(2,2-dichlorocyclopropyl)-phenylmethyl]sulfanyl-5-phenyl-1,2,4-triazole (PubChem CID 134066312) has the molecular formula C24H25Cl2N3S and a molecular weight of 458.46 g/mol. Its IUPAC name is 4-cyclohexyl-3-[(2,2-dichlorocyclopropyl)-phenylmethyl]sulfanyl-5-phenyl-1,2,4-triazole.
| Compound Name | 4-cyclohexyl-3-[(2,2-dichlorocyclopropyl)-phenylmethyl]sulfanyl-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 134066312 |
| Molecular Formula | C24H25Cl2N3S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 4-cyclohexyl-3-[(2,2-dichlorocyclopropyl)-phenylmethyl]sulfanyl-5-phenyl-1,2,4-triazole |
| SMILES | ClC1(Cl)CC1C(Sc1nnc(-c2ccccc2)n1C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H25Cl2N3S/c25-24(26)16-20(24)21(17-10-4-1-5-11-17)30-23-28-27-22(18-12-6-2-7-13-18)29(23)19-14-8-3-9-15-19/h1-2,4-7,10-13,19-21H,3,8-9,14-16H2 |
| InChIKey | MUYCGKWOUIVKET-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|