C17H19NO4S2 — CID 134066790
diethyl 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]propanedioate (PubChem CID 134066790) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is diethyl 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]propanedioate.
| Compound Name | diethyl 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]propanedioate |
|---|---|
| PubChem CID | 134066790 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | diethyl 2-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]sulfanyl]propanedioate |
| SMILES | CCOC(=O)C(Sc1nc(-c2ccc(C)cc2)cs1)C(=O)OCC |
| InChI | InChI=1S/C17H19NO4S2/c1-4-21-15(19)14(16(20)22-5-2)24-17-18-13(10-23-17)12-8-6-11(3)7-9-12/h6-10,14H,4-5H2,1-3H3 |
| InChIKey | RBWXKPUCMXTNJM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|