C15H13Cl2NO3S2 — CID 134066251
ethyl 2-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 134066251) has the molecular formula C15H13Cl2NO3S2 and a molecular weight of 390.31 g/mol. Its IUPAC name is ethyl 2-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 134066251 |
| Molecular Formula | C15H13Cl2NO3S2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | ethyl 2-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nc(-c2ccc(Cl)cc2Cl)cs1)C(C)=O |
| InChI | InChI=1S/C15H13Cl2NO3S2/c1-3-21-14(20)13(8(2)19)23-15-18-12(7-22-15)10-5-4-9(16)6-11(10)17/h4-7,13H,3H2,1-2H3 |
| InChIKey | JBOWSFPECMOJDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|