C15H18Cl2N2O3 — CID 134069399
5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-oxopentanoic acid (PubChem CID 134069399) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 134069399 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-[4-(2,3-dichlorophenyl)piperazin-1-yl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O3/c16-11-3-1-4-12(15(11)17)18-7-9-19(10-8-18)13(20)5-2-6-14(21)22/h1,3-4H,2,5-10H2,(H,21,22) |
| InChIKey | IBXNTHLBVLOTDN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |