About methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate
methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate (PubChem CID 134069534) has the molecular formula C16H19N3O4
and a molecular weight of 317.34 g/mol. Its IUPAC name is methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate |
| PubChem CID | 134069534 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate |
| SMILES | COC(=O)CC(=O)N1CCC2(CC1)NC(=O)c1ccccc1N2 |
| InChI | InChI=1S/C16H19N3O4/c1-23-14(21)10-13(20)19-8-6-16(7-9-19)17-12-5-3-2-4-11(12)15(22)18-16/h2-5,17H,6-10H2,1H3,(H,18,22) |
| InChIKey | NAWLTVMOOQCWJR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate?
The IUPAC name of methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate (CID 134069534) is methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate.
What is the SMILES notation for methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate?
The canonical SMILES for methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate is COC(=O)CC(=O)N1CCC2(CC1)NC(=O)c1ccccc1N2.
What is the InChIKey of methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate?
The InChIKey is NAWLTVMOOQCWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-23-14(21)10-13(20)19-8-6-16(7-9-19)17-12-5-3-2-4-11(12)15(22)18-16/h2-5,17H,6-10H2,1H3,(H,18,22).
What are the key properties of methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate?
methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate has a molecular weight of 317.34 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate is sourced from PubChem (CID 134069534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).