C16H19N3O4 — CID 134069534
methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate (PubChem CID 134069534) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate.
| Compound Name | methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate |
|---|---|
| PubChem CID | 134069534 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 3-oxo-3-(4-oxospiro[1,3-dihydroquinazoline-2,4'-piperidine]-1'-yl)propanoate |
| SMILES | COC(=O)CC(=O)N1CCC2(CC1)NC(=O)c1ccccc1N2 |
| InChI | InChI=1S/C16H19N3O4/c1-23-14(21)10-13(20)19-8-6-16(7-9-19)17-12-5-3-2-4-11(12)15(22)18-16/h2-5,17H,6-10H2,1H3,(H,18,22) |
| InChIKey | NAWLTVMOOQCWJR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|