C11H12 — CID 13407058
3-methyl-6-methylidene-3-prop-2-ynylcyclohexa-1,4-diene (PubChem CID 13407058) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-methyl-6-methylidene-3-prop-2-ynylcyclohexa-1,4-diene.
| Compound Name | 3-methyl-6-methylidene-3-prop-2-ynylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 13407058 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3-methyl-6-methylidene-3-prop-2-ynylcyclohexa-1,4-diene |
| SMILES | C#CCC1(C)C=CC(=C)C=C1 |
| InChI | InChI=1S/C11H12/c1-4-7-11(3)8-5-10(2)6-9-11/h1,5-6,8-9H,2,7H2,3H3 |
| InChIKey | RRHGGNNIUISCBZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|