C13H16 — CID 134973645
1-[(E)-but-1-en-3-ynyl]-2,6,6-trimethylcyclohexa-1,3-diene (PubChem CID 134973645) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-[(E)-but-1-en-3-ynyl]-2,6,6-trimethylcyclohexa-1,3-diene.
| Compound Name | 1-[(E)-but-1-en-3-ynyl]-2,6,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 134973645 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-[(E)-but-1-en-3-ynyl]-2,6,6-trimethylcyclohexa-1,3-diene |
| SMILES | C#C/C=C/C1=C(C)C=CCC1(C)C |
| InChI | InChI=1S/C13H16/c1-5-6-9-12-11(2)8-7-10-13(12,3)4/h1,6-9H,10H2,2-4H3/b9-6+ |
| InChIKey | DKRRTROJHVLGCC-RMKNXTFCSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|