C20H28 — CID 23286470
1-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-2,6,6-trimethylcyclohexa-1,3-diene (PubChem CID 23286470) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-2,6,6-trimethylcyclohexa-1,3-diene.
| Compound Name | 1-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-2,6,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 23286470 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-2,6,6-trimethylcyclohexa-1,3-diene |
| SMILES | C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C=CCC1(C)C |
| InChI | InChI=1S/C20H28/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6/h7-14H,15H2,1-6H3/b10-8+,14-13+,16-7+,17-11+ |
| InChIKey | AJTAWULMWBMRKK-JWBAUCAFSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|