C13H18N4O2 — CID 134071339
9-(6-methoxypyrimidin-4-yl)-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 134071339) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 9-(6-methoxypyrimidin-4-yl)-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-(6-methoxypyrimidin-4-yl)-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 134071339 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 9-(6-methoxypyrimidin-4-yl)-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | COc1cc(N2CCCC3(CCNC3=O)C2)ncn1 |
| InChI | InChI=1S/C13H18N4O2/c1-19-11-7-10(15-9-16-11)17-6-2-3-13(8-17)4-5-14-12(13)18/h7,9H,2-6,8H2,1H3,(H,14,18) |
| InChIKey | ANKUTCGKHMNCJH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |