C12H16N4O2 — CID 140585780
7-(4-methoxypyrimidin-2-yl)-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 140585780) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 7-(4-methoxypyrimidin-2-yl)-2,7-diazaspiro[4.4]nonan-1-one.
| Compound Name | 7-(4-methoxypyrimidin-2-yl)-2,7-diazaspiro[4.4]nonan-1-one |
|---|---|
| PubChem CID | 140585780 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 7-(4-methoxypyrimidin-2-yl)-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | COc1ccnc(N2CCC3(CCNC3=O)C2)n1 |
| InChI | InChI=1S/C12H16N4O2/c1-18-9-2-5-14-11(15-9)16-7-4-12(8-16)3-6-13-10(12)17/h2,5H,3-4,6-8H2,1H3,(H,13,17) |
| InChIKey | LVQRVNWTUZGMOK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |