C14H22N4O3 — CID 134071908
5-ethyl-N-[(4-methoxy-3-nitrophenyl)methyl]-4-methylpyrazolidin-3-amine (PubChem CID 134071908) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 5-ethyl-N-[(4-methoxy-3-nitrophenyl)methyl]-4-methylpyrazolidin-3-amine.
| Compound Name | 5-ethyl-N-[(4-methoxy-3-nitrophenyl)methyl]-4-methylpyrazolidin-3-amine |
|---|---|
| PubChem CID | 134071908 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-ethyl-N-[(4-methoxy-3-nitrophenyl)methyl]-4-methylpyrazolidin-3-amine |
| SMILES | CCC1NNC(NCc2ccc(OC)c([N+](=O)[O-])c2)C1C |
| InChI | InChI=1S/C14H22N4O3/c1-4-11-9(2)14(17-16-11)15-8-10-5-6-13(21-3)12(7-10)18(19)20/h5-7,9,11,14-17H,4,8H2,1-3H3 |
| InChIKey | GQVJJUGAWFOXCM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|