C18H22N4O3 — CID 134075293
N-(3-methoxyphenyl)-4-methyl-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 134075293) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-methyl-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-4-methyl-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134075293 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(3-methoxyphenyl)-4-methyl-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | COc1cccc(NC(=O)C2Cc3c(ncn3C(C)C)N(C)C2=O)c1 |
| InChI | InChI=1S/C18H22N4O3/c1-11(2)22-10-19-16-15(22)9-14(18(24)21(16)3)17(23)20-12-6-5-7-13(8-12)25-4/h5-8,10-11,14H,9H2,1-4H3,(H,20,23) |
| InChIKey | ZIKBGQBKGCAWMU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|