C24H26N4O3 — CID 97442604
(6S)-4-benzyl-N-(3-methoxyphenyl)-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 97442604) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (6S)-4-benzyl-N-(3-methoxyphenyl)-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | (6S)-4-benzyl-N-(3-methoxyphenyl)-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97442604 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (6S)-4-benzyl-N-(3-methoxyphenyl)-5-oxo-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@@H]2Cc3c(ncn3C(C)C)N(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C24H26N4O3/c1-16(2)28-15-25-22-21(28)13-20(23(29)26-18-10-7-11-19(12-18)31-3)24(30)27(22)14-17-8-5-4-6-9-17/h4-12,15-16,20H,13-14H2,1-3H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | PGHALNFRFJSUIX-FQEVSTJZSA-N |
| XLogP | 3.82 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|