C21H25N5O2 — CID 134075648
1H-indol-2-yl-[3-[(1-methylimidazol-2-yl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone (PubChem CID 134075648) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1H-indol-2-yl-[3-[(1-methylimidazol-2-yl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone.
| Compound Name | 1H-indol-2-yl-[3-[(1-methylimidazol-2-yl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
|---|---|
| PubChem CID | 134075648 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1H-indol-2-yl-[3-[(1-methylimidazol-2-yl)amino]-1-oxa-8-azaspiro[4.5]decan-8-yl]methanone |
| SMILES | Cn1ccnc1NC1COC2(CCN(C(=O)c3cc4ccccc4[nH]3)CC2)C1 |
| InChI | InChI=1S/C21H25N5O2/c1-25-11-8-22-20(25)23-16-13-21(28-14-16)6-9-26(10-7-21)19(27)18-12-15-4-2-3-5-17(15)24-18/h2-5,8,11-12,16,24H,6-7,9-10,13-14H2,1H3,(H,22,23) |
| InChIKey | OZOONDXYHCKKJA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |