C14H14F2N2O — CID 68887703
(4,4-difluoropiperidin-1-yl)-(1H-indol-2-yl)methanone (PubChem CID 68887703) has the molecular formula C14H14F2N2O and a molecular weight of 264.27 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-(1H-indol-2-yl)methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 68887703 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-(1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2[nH]1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H14F2N2O/c15-14(16)5-7-18(8-6-14)13(19)12-9-10-3-1-2-4-11(10)17-12/h1-4,9,17H,5-8H2 |
| InChIKey | IAJACKCNGPTFSL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |