C17H19ClF2N2O2 — CID 69282953
[5-(3-chloropropoxy)-1H-indol-2-yl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 69282953) has the molecular formula C17H19ClF2N2O2 and a molecular weight of 356.80 g/mol. Its IUPAC name is [5-(3-chloropropoxy)-1H-indol-2-yl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | [5-(3-chloropropoxy)-1H-indol-2-yl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 69282953 |
| Molecular Formula | C17H19ClF2N2O2 |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [5-(3-chloropropoxy)-1H-indol-2-yl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | O=C(c1cc2cc(OCCCCl)ccc2[nH]1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H19ClF2N2O2/c18-6-1-9-24-13-2-3-14-12(10-13)11-15(21-14)16(23)22-7-4-17(19,20)5-8-22/h2-3,10-11,21H,1,4-9H2 |
| InChIKey | CURDWYAHRNBKDR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|