C23H31F2N3O2 — CID 69283237
(4,4-difluoropiperidin-1-yl)-[5-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]-1H-indol-2-yl]methanone (PubChem CID 69283237) has the molecular formula C23H31F2N3O2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[5-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]-1H-indol-2-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[5-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 69283237 |
| Molecular Formula | C23H31F2N3O2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[5-[3-(2,5-dimethylpyrrolidin-1-yl)propoxy]-1H-indol-2-yl]methanone |
| SMILES | CC1CCC(C)N1CCCOc1ccc2[nH]c(C(=O)N3CCC(F)(F)CC3)cc2c1 |
| InChI | InChI=1S/C23H31F2N3O2/c1-16-4-5-17(2)28(16)10-3-13-30-19-6-7-20-18(14-19)15-21(26-20)22(29)27-11-8-23(24,25)9-12-27/h6-7,14-17,26H,3-5,8-13H2,1-2H3 |
| InChIKey | WVTZFMXFRCQYBM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|