C22H26N2O4S — CID 134077654
2-(4-methoxybenzoyl)-N-(thiophen-2-ylmethyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 134077654) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-(4-methoxybenzoyl)-N-(thiophen-2-ylmethyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | 2-(4-methoxybenzoyl)-N-(thiophen-2-ylmethyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 134077654 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(4-methoxybenzoyl)-N-(thiophen-2-ylmethyl)-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CC(C(=O)NCc3cccs3)C3(CCOCC3)C2)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-27-17-6-4-16(5-7-17)21(26)24-14-19(22(15-24)8-10-28-11-9-22)20(25)23-13-18-3-2-12-29-18/h2-7,12,19H,8-11,13-15H2,1H3,(H,23,25) |
| InChIKey | WZMVJNYVAZAVMJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |