C22H27N3O2S — CID 53184624
2-(pyridine-4-carbonyl)-N-(2-thiophen-2-ylethyl)-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 53184624) has the molecular formula C22H27N3O2S and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-(pyridine-4-carbonyl)-N-(2-thiophen-2-ylethyl)-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | 2-(pyridine-4-carbonyl)-N-(2-thiophen-2-ylethyl)-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 53184624 |
| Molecular Formula | C22H27N3O2S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-(pyridine-4-carbonyl)-N-(2-thiophen-2-ylethyl)-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CN(C(=O)c2ccncc2)CC12CCCCC2 |
| InChI | InChI=1S/C22H27N3O2S/c26-20(24-13-8-18-5-4-14-28-18)19-15-25(16-22(19)9-2-1-3-10-22)21(27)17-6-11-23-12-7-17/h4-7,11-12,14,19H,1-3,8-10,13,15-16H2,(H,24,26) |
| InChIKey | ZACZRURPAIKBTC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |