C21H31N3O2S — CID 53184682
N-(2-pyrrolidin-1-ylethyl)-2-(thiophene-2-carbonyl)-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 53184682) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylethyl)-2-(thiophene-2-carbonyl)-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-(2-pyrrolidin-1-ylethyl)-2-(thiophene-2-carbonyl)-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 53184682 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-(2-pyrrolidin-1-ylethyl)-2-(thiophene-2-carbonyl)-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | O=C(NCCN1CCCC1)C1CN(C(=O)c2cccs2)CC12CCCCC2 |
| InChI | InChI=1S/C21H31N3O2S/c25-19(22-10-13-23-11-4-5-12-23)17-15-24(20(26)18-7-6-14-27-18)16-21(17)8-2-1-3-9-21/h6-7,14,17H,1-5,8-13,15-16H2,(H,22,25) |
| InChIKey | QKSYSLDQLBWGOQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |