C16H19N5OS — CID 134078723
3-methyl-5-[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-1,2,4-oxadiazole (PubChem CID 134078723) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-methyl-5-[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 134078723 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 3-methyl-5-[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]-1,2,4-oxadiazole |
| SMILES | Cc1noc(C2CN(Cc3ccc(C)s3)Cc3ccnn3C2)n1 |
| InChI | InChI=1S/C16H19N5OS/c1-11-3-4-15(23-11)10-20-7-13(16-18-12(2)19-22-16)8-21-14(9-20)5-6-17-21/h3-6,13H,7-10H2,1-2H3 |
| InChIKey | IXXJCOSVPSPONM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |