C17H23N3OS — CID 97381879
(7S)-5-[(5-methylthiophen-2-yl)methyl]-7-(prop-2-enoxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine (PubChem CID 97381879) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is (7S)-5-[(5-methylthiophen-2-yl)methyl]-7-(prop-2-enoxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine.
| Compound Name | (7S)-5-[(5-methylthiophen-2-yl)methyl]-7-(prop-2-enoxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 97381879 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (7S)-5-[(5-methylthiophen-2-yl)methyl]-7-(prop-2-enoxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine |
| SMILES | C=CCOC[C@H]1CN(Cc2ccc(C)s2)Cc2ccnn2C1 |
| InChI | InChI=1S/C17H23N3OS/c1-3-8-21-13-15-9-19(12-17-5-4-14(2)22-17)11-16-6-7-18-20(16)10-15/h3-7,15H,1,8-13H2,2H3/t15-/m0/s1 |
| InChIKey | SJVKJJGQENKNMD-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|