C22H30F6N4O5S — CID 171693884
N,N-dimethyl-2-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171693884) has the molecular formula C22H30F6N4O5S and a molecular weight of 576.56 g/mol. Its IUPAC name is N,N-dimethyl-2-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171693884 |
| Molecular Formula | C22H30F6N4O5S |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | N,N-dimethyl-2-[[5-[(5-methylthiophen-2-yl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2Cc3ccnn3CC(COCCN(C)C)C2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4OS.2C2HF3O2/c1-15-4-5-18(24-15)13-21-10-16(14-23-9-8-20(2)3)11-22-17(12-21)6-7-19-22;2*3-2(4,5)1(6)7/h4-7,16H,8-14H2,1-3H3;2*(H,6,7) |
| InChIKey | XPTJWXFHXFOKGD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|