C19H29N5O — CID 97463391
N,N-dimethyl-2-[[(7R)-5-[(6-methyl-2-pyridinyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine (PubChem CID 97463391) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(7R)-5-[(6-methyl-2-pyridinyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[[(7R)-5-[(6-methyl-2-pyridinyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 97463391 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N,N-dimethyl-2-[[(7R)-5-[(6-methyl-2-pyridinyl)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-7-yl]methoxy]ethanamine |
| SMILES | Cc1cccc(CN2Cc3ccnn3C[C@H](COCCN(C)C)C2)n1 |
| InChI | InChI=1S/C19H29N5O/c1-16-5-4-6-18(21-16)13-23-11-17(15-25-10-9-22(2)3)12-24-19(14-23)7-8-20-24/h4-8,17H,9-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | GRYTXTMKFQYFOI-QGZVFWFLSA-N |
| XLogP | 1.80 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|