C16H19N3O3 — CID 134078784
1-(4-cyanobenzoyl)-4-(dimethylamino)piperidine-2-carboxylic acid (PubChem CID 134078784) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(4-cyanobenzoyl)-4-(dimethylamino)piperidine-2-carboxylic acid.
| Compound Name | 1-(4-cyanobenzoyl)-4-(dimethylamino)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 134078784 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(4-cyanobenzoyl)-4-(dimethylamino)piperidine-2-carboxylic acid |
| SMILES | CN(C)C1CCN(C(=O)c2ccc(C#N)cc2)C(C(=O)O)C1 |
| InChI | InChI=1S/C16H19N3O3/c1-18(2)13-7-8-19(14(9-13)16(21)22)15(20)12-5-3-11(10-17)4-6-12/h3-6,13-14H,7-9H2,1-2H3,(H,21,22) |
| InChIKey | YHSRSIIWWPAMLZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |