C17H23NO4 — CID 50949930
(2R,4S)-1-(4-tert-butylbenzoyl)-4-hydroxypiperidine-2-carboxylic acid (PubChem CID 50949930) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2R,4S)-1-(4-tert-butylbenzoyl)-4-hydroxypiperidine-2-carboxylic acid.
| Compound Name | (2R,4S)-1-(4-tert-butylbenzoyl)-4-hydroxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 50949930 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2R,4S)-1-(4-tert-butylbenzoyl)-4-hydroxypiperidine-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CC[C@H](O)C[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)12-6-4-11(5-7-12)15(20)18-9-8-13(19)10-14(18)16(21)22/h4-7,13-14,19H,8-10H2,1-3H3,(H,21,22)/t13-,14+/m0/s1 |
| InChIKey | CKSKMWAWHHFXNU-UONOGXRCSA-N |
| XLogP | 2.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |