C18H27N3O2 — CID 134078983
8-(oxolan-3-ylmethyl)-N-pyridin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 134078983) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 8-(oxolan-3-ylmethyl)-N-pyridin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine.
| Compound Name | 8-(oxolan-3-ylmethyl)-N-pyridin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
|---|---|
| PubChem CID | 134078983 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 8-(oxolan-3-ylmethyl)-N-pyridin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | c1ccc(NC2COC3(CCN(CC4CCOC4)CC3)C2)nc1 |
| InChI | InChI=1S/C18H27N3O2/c1-2-7-19-17(3-1)20-16-11-18(23-14-16)5-8-21(9-6-18)12-15-4-10-22-13-15/h1-3,7,15-16H,4-6,8-14H2,(H,19,20) |
| InChIKey | PRJIICJQXALDDQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |