C19H25FN2O2 — CID 134080148
(3-fluorophenyl)-(3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decan-8-yl)methanone (PubChem CID 134080148) has the molecular formula C19H25FN2O2 and a molecular weight of 332.42 g/mol. Its IUPAC name is (3-fluorophenyl)-(3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decan-8-yl)methanone.
| Compound Name | (3-fluorophenyl)-(3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 134080148 |
| Molecular Formula | C19H25FN2O2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3-fluorophenyl)-(3-pyrrolidin-1-yl-1-oxa-8-azaspiro[4.5]decan-8-yl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCC2(CC1)CC(N1CCCC1)CO2 |
| InChI | InChI=1S/C19H25FN2O2/c20-16-5-3-4-15(12-16)18(23)22-10-6-19(7-11-22)13-17(14-24-19)21-8-1-2-9-21/h3-5,12,17H,1-2,6-11,13-14H2 |
| InChIKey | DAAZIIPWWIUXLF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |