C18H21N7 — CID 134080308
5-[3-[[4-(2-ethylphenyl)triazol-1-yl]methyl]phenyl]tetrazolidine (PubChem CID 134080308) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is 5-[3-[[4-(2-ethylphenyl)triazol-1-yl]methyl]phenyl]tetrazolidine.
| Compound Name | 5-[3-[[4-(2-ethylphenyl)triazol-1-yl]methyl]phenyl]tetrazolidine |
|---|---|
| PubChem CID | 134080308 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 5-[3-[[4-(2-ethylphenyl)triazol-1-yl]methyl]phenyl]tetrazolidine |
| SMILES | CCc1ccccc1-c1cn(Cc2cccc(C3NNNN3)c2)nn1 |
| InChI | InChI=1S/C18H21N7/c1-2-14-7-3-4-9-16(14)17-12-25(24-19-17)11-13-6-5-8-15(10-13)18-20-22-23-21-18/h3-10,12,18,20-23H,2,11H2,1H3 |
| InChIKey | SYJYIWYYEZBYRA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |