C23H23N3O2 — CID 134083430
1-(3-methylbutyl)-2-(naphthalen-1-ylamino)benzimidazole-5-carboxylic acid (PubChem CID 134083430) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-(3-methylbutyl)-2-(naphthalen-1-ylamino)benzimidazole-5-carboxylic acid.
| Compound Name | 1-(3-methylbutyl)-2-(naphthalen-1-ylamino)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 134083430 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-(3-methylbutyl)-2-(naphthalen-1-ylamino)benzimidazole-5-carboxylic acid |
| SMILES | CC(C)CCn1c(Nc2cccc3ccccc23)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C23H23N3O2/c1-15(2)12-13-26-21-11-10-17(22(27)28)14-20(21)25-23(26)24-19-9-5-7-16-6-3-4-8-18(16)19/h3-11,14-15H,12-13H2,1-2H3,(H,24,25)(H,27,28) |
| InChIKey | KJANQKULAIUDQB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |