C22H20ClN3O3 — CID 134083504
N-[1-[1-[(3-chlorophenyl)methyl]-6-methoxybenzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 134083504) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is N-[1-[1-[(3-chlorophenyl)methyl]-6-methoxybenzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[1-[(3-chlorophenyl)methyl]-6-methoxybenzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134083504 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[1-[1-[(3-chlorophenyl)methyl]-6-methoxybenzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | COc1ccc2nc(C(C)NC(=O)c3ccco3)n(Cc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-14(24-22(27)20-7-4-10-29-20)21-25-18-9-8-17(28-2)12-19(18)26(21)13-15-5-3-6-16(23)11-15/h3-12,14H,13H2,1-2H3,(H,24,27) |
| InChIKey | ADDXKRTVBKMMSW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |