C23H22N4O4 — CID 17030191
N-[1-[1-[2-(4-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 17030191) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[1-[1-[2-(4-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[1-[2-(4-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17030191 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[1-[1-[2-(4-methoxyanilino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)Cn2c(C(C)NC(=O)c3ccco3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H22N4O4/c1-15(24-23(29)20-8-5-13-31-20)22-26-18-6-3-4-7-19(18)27(22)14-21(28)25-16-9-11-17(30-2)12-10-16/h3-13,15H,14H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | WLMIBCSBBZGZIQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |