C21H20N4O4 — CID 17030171
N-[1-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 17030171) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[1-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17030171 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[1-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)c1nc2ccccc2n1CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H20N4O4/c1-14(23-21(27)18-9-5-11-29-18)20-24-16-7-2-3-8-17(16)25(20)13-19(26)22-12-15-6-4-10-28-15/h2-11,14H,12-13H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | UWDSKDNPGDVNCI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |