C28H32N4OS — CID 134083552
N-[1-(1-butyl-5-propylsulfanylbenzimidazol-2-yl)-2-phenylethyl]pyridine-2-carboxamide (PubChem CID 134083552) has the molecular formula C28H32N4OS and a molecular weight of 472.66 g/mol. Its IUPAC name is N-[1-(1-butyl-5-propylsulfanylbenzimidazol-2-yl)-2-phenylethyl]pyridine-2-carboxamide.
| Compound Name | N-[1-(1-butyl-5-propylsulfanylbenzimidazol-2-yl)-2-phenylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134083552 |
| Molecular Formula | C28H32N4OS |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | N-[1-(1-butyl-5-propylsulfanylbenzimidazol-2-yl)-2-phenylethyl]pyridine-2-carboxamide |
| SMILES | CCCCn1c(C(Cc2ccccc2)NC(=O)c2ccccn2)nc2cc(SCCC)ccc21 |
| InChI | InChI=1S/C28H32N4OS/c1-3-5-17-32-26-15-14-22(34-18-4-2)20-24(26)30-27(32)25(19-21-11-7-6-8-12-21)31-28(33)23-13-9-10-16-29-23/h6-16,20,25H,3-5,17-19H2,1-2H3,(H,31,33) |
| InChIKey | SDXUIBNSDGFOEJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |