C18H24N4O5S2 — CID 134085428
[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 134085428) has the molecular formula C18H24N4O5S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134085428 |
| Molecular Formula | C18H24N4O5S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | [2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COCCNc1nc(C(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)cs1 |
| InChI | InChI=1S/C18H24N4O5S2/c1-26-12-7-19-18-20-16(13-28-18)17(23)21-8-10-22(11-9-21)29(24,25)15-5-3-14(27-2)4-6-15/h3-6,13H,7-12H2,1-2H3,(H,19,20) |
| InChIKey | FHUQJDUIGYKZBB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|