C17H19N5O2 — CID 134085508
N-benzyl-5-(2-piperidin-3-yl-1,3-oxazol-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 134085508) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-benzyl-5-(2-piperidin-3-yl-1,3-oxazol-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | N-benzyl-5-(2-piperidin-3-yl-1,3-oxazol-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 134085508 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-benzyl-5-(2-piperidin-3-yl-1,3-oxazol-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc(CNc2nnc(-c3coc(C4CCCNC4)n3)o2)cc1 |
| InChI | InChI=1S/C17H19N5O2/c1-2-5-12(6-3-1)9-19-17-22-21-16(24-17)14-11-23-15(20-14)13-7-4-8-18-10-13/h1-3,5-6,11,13,18H,4,7-10H2,(H,19,22) |
| InChIKey | GMCNCKSMSDBOMP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |