C13H17N3O2 — CID 134086653
1-(2H-1,4-benzoxazin-3-yl)-3-butylurea (PubChem CID 134086653) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-(2H-1,4-benzoxazin-3-yl)-3-butylurea.
| Compound Name | 1-(2H-1,4-benzoxazin-3-yl)-3-butylurea |
|---|---|
| PubChem CID | 134086653 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-(2H-1,4-benzoxazin-3-yl)-3-butylurea |
| SMILES | CCCCNC(=O)NC1=Nc2ccccc2OC1 |
| InChI | InChI=1S/C13H17N3O2/c1-2-3-8-14-13(17)16-12-9-18-11-7-5-4-6-10(11)15-12/h4-7H,2-3,8-9H2,1H3,(H2,14,15,16,17) |
| InChIKey | FDNKAQJKFOCMDY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|