C17H22N2OS — CID 134086903
methyl N-(2,6-diethylphenyl)-N'-(furan-2-ylmethyl)carbamimidothioate (PubChem CID 134086903) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is methyl N-(2,6-diethylphenyl)-N'-(furan-2-ylmethyl)carbamimidothioate.
| Compound Name | methyl N-(2,6-diethylphenyl)-N'-(furan-2-ylmethyl)carbamimidothioate |
|---|---|
| PubChem CID | 134086903 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl N-(2,6-diethylphenyl)-N'-(furan-2-ylmethyl)carbamimidothioate |
| SMILES | CCc1cccc(CC)c1N/C(=N/Cc1ccco1)SC |
| InChI | InChI=1S/C17H22N2OS/c1-4-13-8-6-9-14(5-2)16(13)19-17(21-3)18-12-15-10-7-11-20-15/h6-11H,4-5,12H2,1-3H3,(H,18,19) |
| InChIKey | ZJYQSJOTBHZFSI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|