C15H13F3N2O3S — CID 134087800
2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazole (PubChem CID 134087800) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 134087800 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3,4-oxadiazole |
| SMILES | FC(F)=C(F)CCSc1nnc(Cc2ccc3c(c2)OCCO3)o1 |
| InChI | InChI=1S/C15H13F3N2O3S/c16-10(14(17)18)3-6-24-15-20-19-13(23-15)8-9-1-2-11-12(7-9)22-5-4-21-11/h1-2,7H,3-6,8H2 |
| InChIKey | SIEPPDXNZWJXLN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |